About CID 175102486
CID 175102486 (PubChem CID 175102486) has the molecular formula C6H4BrInO
and a molecular weight of 286.82 g/mol.
Molecular Properties
| Compound Name | CID 175102486 |
| PubChem CID | 175102486 |
| Molecular Formula | C6H4BrInO |
| Molecular Weight | 286.82 g/mol |
| Exact Mass | 285.85 |
| IUPAC Name | — |
| SMILES | Oc1cc(Br)ccc1[In] |
| InChI | InChI=1S/C6H4BrO.In/c7-5-2-1-3-6(8)4-5;/h1-2,4,8H; |
| InChIKey | QLEKJYYQRZNTJO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.82 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 175102486 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175102486?
The IUPAC name of CID 175102486 (CID 175102486) is not available.
What is the SMILES notation for CID 175102486?
The canonical SMILES for CID 175102486 is Oc1cc(Br)ccc1[In].
What is the InChIKey of CID 175102486?
The InChIKey is QLEKJYYQRZNTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrO.In/c7-5-2-1-3-6(8)4-5;/h1-2,4,8H;.
What are the key properties of CID 175102486?
CID 175102486 has a molecular weight of 286.82 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175102486 is sourced from PubChem (CID 175102486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).