C24H21F4N5O — CID 168750179
N-[1-[3-amino-6-fluoro-5-(trifluoromethyl)-2-pyridinyl]-1-(2-cyanocyclopentyl)ethyl]quinoline-6-carboxamide (PubChem CID 168750179) has the molecular formula C24H21F4N5O and a molecular weight of 471.46 g/mol. Its IUPAC name is N-[1-[3-amino-6-fluoro-5-(trifluoromethyl)-2-pyridinyl]-1-(2-cyanocyclopentyl)ethyl]quinoline-6-carboxamide.
| Compound Name | N-[1-[3-amino-6-fluoro-5-(trifluoromethyl)-2-pyridinyl]-1-(2-cyanocyclopentyl)ethyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 168750179 |
| Molecular Formula | C24H21F4N5O |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[1-[3-amino-6-fluoro-5-(trifluoromethyl)-2-pyridinyl]-1-(2-cyanocyclopentyl)ethyl]quinoline-6-carboxamide |
| SMILES | CC(NC(=O)c1ccc2ncccc2c1)(c1nc(F)c(C(F)(F)F)cc1N)C1CCCC1C#N |
| InChI | InChI=1S/C24H21F4N5O/c1-23(16-6-2-4-15(16)12-29,20-18(30)11-17(21(25)32-20)24(26,27)28)33-22(34)14-7-8-19-13(10-14)5-3-9-31-19/h3,5,7-11,15-16H,2,4,6,30H2,1H3,(H,33,34) |
| InChIKey | XPWVMPWFPAASQJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|