C10H6FIN6 — CID 168758981
7-(4-fluorophenyl)-8-iodotetrazolo[1,5-c]pyrimidin-5-amine (PubChem CID 168758981) has the molecular formula C10H6FIN6 and a molecular weight of 356.10 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-8-iodotetrazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 7-(4-fluorophenyl)-8-iodotetrazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 168758981 |
| Molecular Formula | C10H6FIN6 |
| Molecular Weight | 356.10 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 7-(4-fluorophenyl)-8-iodotetrazolo[1,5-c]pyrimidin-5-amine |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(I)c2nnnn12 |
| InChI | InChI=1S/C10H6FIN6/c11-6-3-1-5(2-4-6)8-7(12)9-15-16-17-18(9)10(13)14-8/h1-4H,(H2,13,14) |
| InChIKey | NVUZQZNEJSUHMH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.10 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|