C25H27FN2O3 — CID 168761535
(5S,7aR)-1'-(3,5-dimethylbenzoyl)-5-(3-fluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one (PubChem CID 168761535) has the molecular formula C25H27FN2O3 and a molecular weight of 422.50 g/mol. Its IUPAC name is (5S,7aR)-1'-(3,5-dimethylbenzoyl)-5-(3-fluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one.
| Compound Name | (5S,7aR)-1'-(3,5-dimethylbenzoyl)-5-(3-fluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 168761535 |
| Molecular Formula | C25H27FN2O3 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (5S,7aR)-1'-(3,5-dimethylbenzoyl)-5-(3-fluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
| SMILES | Cc1cc(C)cc(C(=O)N2CCC3(CC2)O[C@@H]2CC[C@@H](c4cccc(F)c4)N2C3=O)c1 |
| InChI | InChI=1S/C25H27FN2O3/c1-16-12-17(2)14-19(13-16)23(29)27-10-8-25(9-11-27)24(30)28-21(6-7-22(28)31-25)18-4-3-5-20(26)15-18/h3-5,12-15,21-22H,6-11H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | AUCRRAVHQRHOCP-FCHUYYIVSA-N |
| XLogP | 4.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |