C24H22F4N2O4 — CID 168761715
(5S,7aR)-1'-[2-(difluoromethoxy)benzoyl]-5-(3,5-difluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one (PubChem CID 168761715) has the molecular formula C24H22F4N2O4 and a molecular weight of 478.44 g/mol. Its IUPAC name is (5S,7aR)-1'-[2-(difluoromethoxy)benzoyl]-5-(3,5-difluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one.
| Compound Name | (5S,7aR)-1'-[2-(difluoromethoxy)benzoyl]-5-(3,5-difluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 168761715 |
| Molecular Formula | C24H22F4N2O4 |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | (5S,7aR)-1'-[2-(difluoromethoxy)benzoyl]-5-(3,5-difluorophenyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
| SMILES | O=C(c1ccccc1OC(F)F)N1CCC2(CC1)O[C@@H]1CC[C@@H](c3cc(F)cc(F)c3)N1C2=O |
| InChI | InChI=1S/C24H22F4N2O4/c25-15-11-14(12-16(26)13-15)18-5-6-20-30(18)22(32)24(34-20)7-9-29(10-8-24)21(31)17-3-1-2-4-19(17)33-23(27)28/h1-4,11-13,18,20,23H,5-10H2/t18-,20+/m0/s1 |
| InChIKey | SRQBYPPNMNJSDE-AZUAARDMSA-N |
| XLogP | 4.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |