C53H38N4OPt-2 — CID 168782311
CID 168782311 (PubChem CID 168782311) has the molecular formula C53H38N4OPt-2 and a molecular weight of 950.04 g/mol.
| Compound Name | CID 168782311 |
|---|---|
| PubChem CID | 168782311 |
| Molecular Formula | C53H38N4OPt-2 |
| Molecular Weight | 950.04 g/mol |
| Exact Mass | 949.32 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])-c1ccccc1-[n+]1[c-]n(-c3[c-]c(Oc4[c-]c5c(cc4)c4ccccc4n5-c4cc(CC(C)(C)C)ccn4)ccc3)c3cccc(c31)-c1c([2H])c([2H])c([2H])c([2H])c1-2.[Pt] |
| InChI | InChI=1S/C53H38N4O.Pt/c1-53(2,3)33-35-28-29-54-51(30-35)57-48-24-11-9-21-44(48)45-27-26-38(32-50(45)57)58-37-15-12-14-36(31-37)55-34-56-47-23-10-8-20-43(47)41-18-6-4-16-39(41)40-17-5-7-19-42(40)46-22-13-25-49(55)52(46)56;/h4-30H,33H2,1-3H3;/q-2;/i4D,5D,6D,7D,16D,17D,18D,19D; |
| InChIKey | MAZHNCKYCCPPPD-QMGCHWPDSA-N |
| XLogP | 12.49 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.04 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|