C54H36N4OPt-2 — CID 177303523
CID 177303523 (PubChem CID 177303523) has the molecular formula C54H36N4OPt-2 and a molecular weight of 951.99 g/mol.
| Compound Name | CID 177303523 |
|---|---|
| PubChem CID | 177303523 |
| Molecular Formula | C54H36N4OPt-2 |
| Molecular Weight | 951.99 g/mol |
| Exact Mass | 951.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+]6c7c(cccc75)-c5cccc7c5C5c8ccccc8C7c7c5cccc7-6)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C54H36N4O.Pt/c1-54(2,3)32-26-27-55-48(28-32)58-44-21-7-6-14-36(44)37-25-24-35(30-47(37)58)59-34-13-8-12-33(29-34)56-31-57-45-22-11-20-43-49-38-15-4-5-16-39(38)51(52(43)45)42-19-9-17-40(50(42)49)41-18-10-23-46(56)53(41)57;/h4-28,49,51H,1-3H3;/q-2; |
| InChIKey | ZVKBADVMEZPJCF-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.99 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|