About CID 177303405
CID 177303405 (PubChem CID 177303405) has the molecular formula C54H36N4OPt-2
and a molecular weight of 951.99 g/mol.
Molecular Properties
| Compound Name | CID 177303405 |
| PubChem CID | 177303405 |
| Molecular Formula | C54H36N4OPt-2 |
| Molecular Weight | 951.99 g/mol |
| Exact Mass | 951.25 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+]6c7c(cccc75)-c5ccc7c(c5)C5c8ccccc8C7c7c5cccc7-6)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C54H36N4O.Pt/c1-54(2,3)33-25-26-55-49(28-33)58-45-18-7-6-13-38(45)39-24-22-36(30-48(39)58)59-35-12-8-11-34(29-35)56-31-57-46-19-10-17-43-50-40-14-4-5-15-41(40)51(52(43)46)42-23-21-32(27-44(42)50)37-16-9-20-47(56)53(37)57;/h4-28,50-51H,1-3H3;/q-2; |
| InChIKey | AZBQBPWRGCDHAC-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 951.99 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 177303405 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177303405?
The IUPAC name of CID 177303405 (CID 177303405) is not available.
What is the SMILES notation for CID 177303405?
The canonical SMILES for CID 177303405 is CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+]6c7c(cccc75)-c5ccc7c(c5)C5c8ccccc8C7c7c5cccc7-6)ccc4)ccc3c3ccccc32)c1.[Pt].
What is the InChIKey of CID 177303405?
The InChIKey is AZBQBPWRGCDHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C54H36N4O.Pt/c1-54(2,3)33-25-26-55-49(28-33)58-45-18-7-6-13-38(45)39-24-22-36(30-48(39)58)59-35-12-8-11-34(29-35)56-31-57-46-19-10-17-43-50-40-14-4-5-15-41(40)51(52(43)46)42-23-21-32(27-44(42)50)37-16-9-20-47(56)53(37)57;/h4-28,50-51H,1-3H3;/q-2;.
What are the key properties of CID 177303405?
CID 177303405 has a molecular weight of 951.99 g/mol, XLogP of 11.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177303405 is sourced from PubChem (CID 177303405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).