C24H25Br2F3N4O3S — CID 168786175
N-[3-[6-bromohexyl-(4-bromophenyl)sulfinamoyl]-4-methoxyphenyl]-2-(trifluoromethyl)-1H-imidazole-5-carboxamide (PubChem CID 168786175) has the molecular formula C24H25Br2F3N4O3S and a molecular weight of 666.36 g/mol. Its IUPAC name is N-[3-[6-bromohexyl-(4-bromophenyl)sulfinamoyl]-4-methoxyphenyl]-2-(trifluoromethyl)-1H-imidazole-5-carboxamide.
| Compound Name | N-[3-[6-bromohexyl-(4-bromophenyl)sulfinamoyl]-4-methoxyphenyl]-2-(trifluoromethyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 168786175 |
| Molecular Formula | C24H25Br2F3N4O3S |
| Molecular Weight | 666.36 g/mol |
| Exact Mass | 664.00 |
| IUPAC Name | N-[3-[6-bromohexyl-(4-bromophenyl)sulfinamoyl]-4-methoxyphenyl]-2-(trifluoromethyl)-1H-imidazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnc(C(F)(F)F)[nH]2)cc1S(=O)N(CCCCCCBr)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H25Br2F3N4O3S/c1-36-20-11-8-17(31-22(34)19-15-30-23(32-19)24(27,28)29)14-21(20)37(35)33(13-5-3-2-4-12-25)18-9-6-16(26)7-10-18/h6-11,14-15H,2-5,12-13H2,1H3,(H,30,32)(H,31,34) |
| InChIKey | WPASTGVZFFSOJK-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.36 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|