C23H26BrN7O4S — CID 166748366
N-[3-[6-azidohexyl-(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-1H-imidazole-5-carboxamide (PubChem CID 166748366) has the molecular formula C23H26BrN7O4S and a molecular weight of 576.48 g/mol. Its IUPAC name is N-[3-[6-azidohexyl-(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[3-[6-azidohexyl-(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 166748366 |
| Molecular Formula | C23H26BrN7O4S |
| Molecular Weight | 576.48 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | N-[3-[6-azidohexyl-(4-bromophenyl)sulfamoyl]-4-methoxyphenyl]-1H-imidazole-5-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnc[nH]2)cc1S(=O)(=O)N(CCCCCCN=[N+]=[N-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H26BrN7O4S/c1-35-21-11-8-18(29-23(32)20-15-26-16-27-20)14-22(21)36(33,34)31(19-9-6-17(24)7-10-19)13-5-3-2-4-12-28-30-25/h6-11,14-16H,2-5,12-13H2,1H3,(H,26,27)(H,29,32) |
| InChIKey | HRMKEDVECYXZPY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 153.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|