C17H21N3O3 — CID 168786731
N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-methyl-2-oxopiperidine-3-carboxamide (PubChem CID 168786731) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-methyl-2-oxopiperidine-3-carboxamide.
| Compound Name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-methyl-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 168786731 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-methyl-2-oxopiperidine-3-carboxamide |
| SMILES | CC1(C(=O)NCCc2c[nH]c3ccc(O)cc23)CCCNC1=O |
| InChI | InChI=1S/C17H21N3O3/c1-17(6-2-7-18-15(17)22)16(23)19-8-5-11-10-20-14-4-3-12(21)9-13(11)14/h3-4,9-10,20-21H,2,5-8H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | NFPATAFMVWTJRJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|