C18H26N2O2 — CID 143884091
N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-2,2,4-trimethylpentanamide (PubChem CID 143884091) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-2,2,4-trimethylpentanamide.
| Compound Name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-2,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 143884091 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-2,2,4-trimethylpentanamide |
| SMILES | CC(C)CC(C)(C)C(=O)NCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C18H26N2O2/c1-12(2)10-18(3,4)17(22)19-8-7-13-11-20-16-6-5-14(21)9-15(13)16/h5-6,9,11-12,20-21H,7-8,10H2,1-4H3,(H,19,22) |
| InChIKey | VLCGFZHFFULIIY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |