C33H41FN2O5 — CID 168793474
tert-butyl 2-[1-[4-(6-butoxy-2-phenylmethoxy-3-pyridinyl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate (PubChem CID 168793474) has the molecular formula C33H41FN2O5 and a molecular weight of 564.70 g/mol. Its IUPAC name is tert-butyl 2-[1-[4-(6-butoxy-2-phenylmethoxy-3-pyridinyl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[4-(6-butoxy-2-phenylmethoxy-3-pyridinyl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 168793474 |
| Molecular Formula | C33H41FN2O5 |
| Molecular Weight | 564.70 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | tert-butyl 2-[1-[4-(6-butoxy-2-phenylmethoxy-3-pyridinyl)-2-fluorophenyl]-4-hydroxypiperidin-4-yl]acetate |
| SMILES | CCCCOc1ccc(-c2ccc(N3CCC(O)(CC(=O)OC(C)(C)C)CC3)c(F)c2)c(OCc2ccccc2)n1 |
| InChI | InChI=1S/C33H41FN2O5/c1-5-6-20-39-29-15-13-26(31(35-29)40-23-24-10-8-7-9-11-24)25-12-14-28(27(34)21-25)36-18-16-33(38,17-19-36)22-30(37)41-32(2,3)4/h7-15,21,38H,5-6,16-20,22-23H2,1-4H3 |
| InChIKey | YXVLOBJRTBYRSX-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|