C18H26N4O3 — CID 168795078
6-[[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazine-3-carboxylic acid (PubChem CID 168795078) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 6-[[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazine-3-carboxylic acid.
| Compound Name | 6-[[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 168795078 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 6-[[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(N[C@H]2C[C@@H]3CN[C@@H](CC4CCOCC4)[C@H]3C2)nn1 |
| InChI | InChI=1S/C18H26N4O3/c23-18(24)15-1-2-17(22-21-15)20-13-8-12-10-19-16(14(12)9-13)7-11-3-5-25-6-4-11/h1-2,11-14,16,19H,3-10H2,(H,20,22)(H,23,24)/t12-,13+,14+,16+/m1/s1 |
| InChIKey | CXQCZWOFSQHGLX-HOSILWTGSA-N |
| XLogP | 1.77 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |