C25H29N7O — CID 168795143
3-[[(3S,3aS,5S,6aS)-3-[[(3S)-oxolan-3-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]-6-(2-methylindazol-5-yl)pyridazine-4-carbonitrile (PubChem CID 168795143) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 3-[[(3S,3aS,5S,6aS)-3-[[(3S)-oxolan-3-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]-6-(2-methylindazol-5-yl)pyridazine-4-carbonitrile.
| Compound Name | 3-[[(3S,3aS,5S,6aS)-3-[[(3S)-oxolan-3-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]-6-(2-methylindazol-5-yl)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 168795143 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 3-[[(3S,3aS,5S,6aS)-3-[[(3S)-oxolan-3-yl]methyl]-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]-6-(2-methylindazol-5-yl)pyridazine-4-carbonitrile |
| SMILES | Cn1cc2cc(-c3cc(C#N)c(N[C@H]4C[C@@H]5CN[C@@H](C[C@H]6CCOC6)[C@H]5C4)nn3)ccc2n1 |
| InChI | InChI=1S/C25H29N7O/c1-32-13-19-7-16(2-3-22(19)31-32)23-9-17(11-26)25(30-29-23)28-20-8-18-12-27-24(21(18)10-20)6-15-4-5-33-14-15/h2-3,7,9,13,15,18,20-21,24,27H,4-6,8,10,12,14H2,1H3,(H,28,30)/t15-,18-,20+,21+,24+/m1/s1 |
| InChIKey | PADRPFIRSFSXLO-WVZPFBDSSA-N |
| XLogP | 3.11 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |