C26H31FN4OS — CID 156720471
N-[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-(5-fluoro-2-methylphenyl)thieno[2,3-d]pyridazin-7-amine (PubChem CID 156720471) has the molecular formula C26H31FN4OS and a molecular weight of 466.63 g/mol. Its IUPAC name is N-[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-(5-fluoro-2-methylphenyl)thieno[2,3-d]pyridazin-7-amine.
| Compound Name | N-[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-(5-fluoro-2-methylphenyl)thieno[2,3-d]pyridazin-7-amine |
|---|---|
| PubChem CID | 156720471 |
| Molecular Formula | C26H31FN4OS |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-[(3S,3aS,5S,6aS)-3-(oxan-4-ylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]-3-(5-fluoro-2-methylphenyl)thieno[2,3-d]pyridazin-7-amine |
| SMILES | Cc1ccc(F)cc1-c1csc2c(N[C@H]3C[C@@H]4CN[C@@H](CC5CCOCC5)[C@H]4C3)nncc12 |
| InChI | InChI=1S/C26H31FN4OS/c1-15-2-3-18(27)10-20(15)23-14-33-25-22(23)13-29-31-26(25)30-19-9-17-12-28-24(21(17)11-19)8-16-4-6-32-7-5-16/h2-3,10,13-14,16-17,19,21,24,28H,4-9,11-12H2,1H3,(H,30,31)/t17-,19+,21+,24+/m1/s1 |
| InChIKey | BVBIHSDJVMKRSN-OEEWACLQSA-N |
| XLogP | 5.40 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |