C24H33N5O — CID 163370158
5-[6-[[(3S,3aS,5S,6aS)-3-(cyclohexylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one (PubChem CID 163370158) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is 5-[6-[[(3S,3aS,5S,6aS)-3-(cyclohexylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[6-[[(3S,3aS,5S,6aS)-3-(cyclohexylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 163370158 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 5-[6-[[(3S,3aS,5S,6aS)-3-(cyclohexylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(-c2ccc(N[C@H]3C[C@@H]4CN[C@@H](CC5CCCCC5)[C@H]4C3)nn2)ccc1=O |
| InChI | InChI=1S/C24H33N5O/c1-29-15-17(7-10-24(29)30)21-8-9-23(28-27-21)26-19-12-18-14-25-22(20(18)13-19)11-16-5-3-2-4-6-16/h7-10,15-16,18-20,22,25H,2-6,11-14H2,1H3,(H,26,28)/t18-,19+,20+,22+/m1/s1 |
| InChIKey | JYCMZAKMKYAYAT-AQCRLBJHSA-N |
| XLogP | 3.59 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |