C23H26N6O — CID 175988017
5-[6-[[(3aR,6aS)-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one (PubChem CID 175988017) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 5-[6-[[(3aR,6aS)-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[6-[[(3aR,6aS)-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 175988017 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 5-[6-[[(3aR,6aS)-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]amino]pyridazin-3-yl]-1-methylpyridin-2-one |
| SMILES | Cn1cc(-c2ccc(NC3C[C@@H]4CN(Cc5ccccn5)C[C@@H]4C3)nn2)ccc1=O |
| InChI | InChI=1S/C23H26N6O/c1-28-12-16(5-8-23(28)30)21-6-7-22(27-26-21)25-20-10-17-13-29(14-18(17)11-20)15-19-4-2-3-9-24-19/h2-9,12,17-18,20H,10-11,13-15H2,1H3,(H,25,27)/t17-,18+,20? |
| InChIKey | WMGCSVQRYILDSS-UFRUDQCGSA-N |
| XLogP | 2.56 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |