C24H24F3N5O2S — CID 166793899
(3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 166793899) has the molecular formula C24H24F3N5O2S and a molecular weight of 503.55 g/mol. Its IUPAC name is (3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 166793899 |
| Molecular Formula | C24H24F3N5O2S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | (3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[[3-(trifluoromethyl)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(NC2C[C@@H]3CN(Cc4ncccc4C(F)(F)F)C[C@@H]3C2)nn1 |
| InChI | InChI=1S/C24H24F3N5O2S/c25-24(26,27)20-7-4-10-28-21(20)15-32-13-16-11-18(12-17(16)14-32)29-22-8-9-23(31-30-22)35(33,34)19-5-2-1-3-6-19/h1-10,16-18H,11-15H2,(H,29,30)/t16-,17+,18? |
| InChIKey | MQAHCGRLSGVCIR-JWTNVVGKSA-N |
| XLogP | 4.05 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |