C24H27N5O2S — CID 166793825
(3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[(3-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 166793825) has the molecular formula C24H27N5O2S and a molecular weight of 449.58 g/mol. Its IUPAC name is (3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[(3-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[(3-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 166793825 |
| Molecular Formula | C24H27N5O2S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | (3aR,6aS)-N-[6-(benzenesulfonyl)pyridazin-3-yl]-2-[(3-methyl-2-pyridinyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Cc1cccnc1CN1C[C@H]2CC(Nc3ccc(S(=O)(=O)c4ccccc4)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C24H27N5O2S/c1-17-6-5-11-25-22(17)16-29-14-18-12-20(13-19(18)15-29)26-23-9-10-24(28-27-23)32(30,31)21-7-3-2-4-8-21/h2-11,18-20H,12-16H2,1H3,(H,26,27)/t18-,19+,20? |
| InChIKey | NEZMFWNNKVZUOK-YOFSQIOKSA-N |
| XLogP | 3.34 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |