C19H25N3O2S — CID 53073339
N-cycloheptyl-6-(3,4-dimethylphenyl)sulfonylpyridazin-3-amine (PubChem CID 53073339) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-cycloheptyl-6-(3,4-dimethylphenyl)sulfonylpyridazin-3-amine.
| Compound Name | N-cycloheptyl-6-(3,4-dimethylphenyl)sulfonylpyridazin-3-amine |
|---|---|
| PubChem CID | 53073339 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-cycloheptyl-6-(3,4-dimethylphenyl)sulfonylpyridazin-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(NC3CCCCCC3)nn2)cc1C |
| InChI | InChI=1S/C19H25N3O2S/c1-14-9-10-17(13-15(14)2)25(23,24)19-12-11-18(21-22-19)20-16-7-5-3-4-6-8-16/h9-13,16H,3-8H2,1-2H3,(H,20,21) |
| InChIKey | UZTIYODLJRFCIC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |