C22H30N4O2S — CID 53073343
3-(4-cyclohexylpiperazin-1-yl)-6-(3,4-dimethylphenyl)sulfonylpyridazine (PubChem CID 53073343) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is 3-(4-cyclohexylpiperazin-1-yl)-6-(3,4-dimethylphenyl)sulfonylpyridazine.
| Compound Name | 3-(4-cyclohexylpiperazin-1-yl)-6-(3,4-dimethylphenyl)sulfonylpyridazine |
|---|---|
| PubChem CID | 53073343 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-(4-cyclohexylpiperazin-1-yl)-6-(3,4-dimethylphenyl)sulfonylpyridazine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(N3CCN(C4CCCCC4)CC3)nn2)cc1C |
| InChI | InChI=1S/C22H30N4O2S/c1-17-8-9-20(16-18(17)2)29(27,28)22-11-10-21(23-24-22)26-14-12-25(13-15-26)19-6-4-3-5-7-19/h8-11,16,19H,3-7,12-15H2,1-2H3 |
| InChIKey | QCEBULZXVAAHGX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |