C20H25ClN4O2S — CID 53073249
3-(4-chlorophenyl)sulfonyl-6-(4-cyclohexylpiperazin-1-yl)pyridazine (PubChem CID 53073249) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-6-(4-cyclohexylpiperazin-1-yl)pyridazine.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-6-(4-cyclohexylpiperazin-1-yl)pyridazine |
|---|---|
| PubChem CID | 53073249 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-6-(4-cyclohexylpiperazin-1-yl)pyridazine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1ccc(N2CCN(C3CCCCC3)CC2)nn1 |
| InChI | InChI=1S/C20H25ClN4O2S/c21-16-6-8-18(9-7-16)28(26,27)20-11-10-19(22-23-20)25-14-12-24(13-15-25)17-4-2-1-3-5-17/h6-11,17H,1-5,12-15H2 |
| InChIKey | LOEHBBIVMVHHDH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |