C23H28F3N5O — CID 169222036
2-[dideuterio-[(3S)-oxan-3-yl]methyl]-N-[6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 169222036) has the molecular formula C23H28F3N5O and a molecular weight of 449.52 g/mol. Its IUPAC name is 2-[dideuterio-[(3S)-oxan-3-yl]methyl]-N-[6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | 2-[dideuterio-[(3S)-oxan-3-yl]methyl]-N-[6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 169222036 |
| Molecular Formula | C23H28F3N5O |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[dideuterio-[(3S)-oxan-3-yl]methyl]-N-[6-[2-(trifluoromethyl)-3-pyridinyl]pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | [2H]C([2H])([C@@H]1CCCOC1)N1CC2CC(Nc3ccc(-c4cccnc4C(F)(F)F)nn3)CC2C1 |
| InChI | InChI=1S/C23H28F3N5O/c24-23(25,26)22-19(4-1-7-27-22)20-5-6-21(30-29-20)28-18-9-16-12-31(13-17(16)10-18)11-15-3-2-8-32-14-15/h1,4-7,15-18H,2-3,8-14H2,(H,28,30)/t15-,16?,17?,18?/m0/s1/i11D2 |
| InChIKey | BIVWOXQVYAKHBE-ZMBFHLDYSA-N |
| XLogP | 4.11 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |