C54H34B2N2 — CID 168795564
2-[3,8-bis[bis(2,3,4,5,6-pentadeuteriophenyl)boranyl]-6-(2-isocyanophenyl)pyren-1-yl]benzonitrile (PubChem CID 168795564) has the molecular formula C54H34B2N2 and a molecular weight of 752.63 g/mol. Its IUPAC name is 2-[3,8-bis[bis(2,3,4,5,6-pentadeuteriophenyl)boranyl]-6-(2-isocyanophenyl)pyren-1-yl]benzonitrile.
| Compound Name | 2-[3,8-bis[bis(2,3,4,5,6-pentadeuteriophenyl)boranyl]-6-(2-isocyanophenyl)pyren-1-yl]benzonitrile |
|---|---|
| PubChem CID | 168795564 |
| Molecular Formula | C54H34B2N2 |
| Molecular Weight | 752.63 g/mol |
| Exact Mass | 752.42 |
| IUPAC Name | 2-[3,8-bis[bis(2,3,4,5,6-pentadeuteriophenyl)boranyl]-6-(2-isocyanophenyl)pyren-1-yl]benzonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(B(c2c([2H])c([2H])c([2H])c([2H])c2[2H])c2cc(-c3ccccc3C#N)c3ccc4c(B(c5c([2H])c([2H])c([2H])c([2H])c5[2H])c5c([2H])c([2H])c([2H])c([2H])c5[2H])cc(-c5ccccc5[N+]#[C-])c5ccc2c3c45)c([2H])c1[2H] |
| InChI | InChI=1S/C54H34B2N2/c1-58-52-29-17-16-28-43(52)49-35-51(56(40-23-10-4-11-24-40)41-25-12-5-13-26-41)47-32-30-44-48(42-27-15-14-18-37(42)36-57)34-50(46-33-31-45(49)54(47)53(44)46)55(38-19-6-2-7-20-38)39-21-8-3-9-22-39/h2-35H/i2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,19D,20D,21D,22D,23D,24D,25D,26D |
| InChIKey | YKPRQVNFRBXDAG-FNGWJYPWSA-N |
| XLogP | 9.37 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.63 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|