C8H21N3 — CID 168800021
1-N-(aminomethyl)-2-methyl-1-N'-propan-2-ylpropane-1,1-diamine (PubChem CID 168800021) has the molecular formula C8H21N3 and a molecular weight of 159.28 g/mol. Its IUPAC name is 1-N-(aminomethyl)-2-methyl-1-N'-propan-2-ylpropane-1,1-diamine.
| Compound Name | 1-N-(aminomethyl)-2-methyl-1-N'-propan-2-ylpropane-1,1-diamine |
|---|---|
| PubChem CID | 168800021 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | 1-N-(aminomethyl)-2-methyl-1-N'-propan-2-ylpropane-1,1-diamine |
| SMILES | CC(C)NC(NCN)C(C)C |
| InChI | InChI=1S/C8H21N3/c1-6(2)8(10-5-9)11-7(3)4/h6-8,10-11H,5,9H2,1-4H3 |
| InChIKey | VMMRUAGXXVBMPO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|