C20H15FN2O — CID 168800789
1-(4-fluorophenyl)-7-pyridin-4-yl-2,3-dihydroquinolin-4-one (PubChem CID 168800789) has the molecular formula C20H15FN2O and a molecular weight of 318.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-7-pyridin-4-yl-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(4-fluorophenyl)-7-pyridin-4-yl-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 168800789 |
| Molecular Formula | C20H15FN2O |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(4-fluorophenyl)-7-pyridin-4-yl-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(c2ccc(F)cc2)c2cc(-c3ccncc3)ccc21 |
| InChI | InChI=1S/C20H15FN2O/c21-16-2-4-17(5-3-16)23-12-9-20(24)18-6-1-15(13-19(18)23)14-7-10-22-11-8-14/h1-8,10-11,13H,9,12H2 |
| InChIKey | DRWGURQNVWTGHL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |