C19H15FN2O — CID 59988451
1-(4-fluorophenyl)-2-pyridin-4-yl-6,7-dihydro-5H-indolizin-8-one (PubChem CID 59988451) has the molecular formula C19H15FN2O and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-pyridin-4-yl-6,7-dihydro-5H-indolizin-8-one.
| Compound Name | 1-(4-fluorophenyl)-2-pyridin-4-yl-6,7-dihydro-5H-indolizin-8-one |
|---|---|
| PubChem CID | 59988451 |
| Molecular Formula | C19H15FN2O |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(4-fluorophenyl)-2-pyridin-4-yl-6,7-dihydro-5H-indolizin-8-one |
| SMILES | O=C1CCCn2cc(-c3ccncc3)c(-c3ccc(F)cc3)c21 |
| InChI | InChI=1S/C19H15FN2O/c20-15-5-3-14(4-6-15)18-16(13-7-9-21-10-8-13)12-22-11-1-2-17(23)19(18)22/h3-10,12H,1-2,11H2 |
| InChIKey | CNCKROLBACDTDP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |