About 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride
2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride (PubChem CID 16881) has the molecular formula C17H28ClNO3
and a molecular weight of 329.87 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride |
| PubChem CID | 16881 |
| Molecular Formula | C17H28ClNO3 |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride |
| SMILES | CCCCOc1ccc(C(=O)OCCN(CC)CC)cc1.Cl |
| InChI | InChI=1S/C17H27NO3.ClH/c1-4-7-13-20-16-10-8-15(9-11-16)17(19)21-14-12-18(5-2)6-3;/h8-11H,4-7,12-14H2,1-3H3;1H |
| InChIKey | GDGCCLGDBQIELP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride (CID 16881) is 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride is CCCCOc1ccc(C(=O)OCCN(CC)CC)cc1.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride?
The InChIKey is GDGCCLGDBQIELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO3.ClH/c1-4-7-13-20-16-10-8-15(9-11-16)17(19)21-14-12-18(5-2)6-3;/h8-11H,4-7,12-14H2,1-3H3;1H.
What are the key properties of 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride?
2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride has a molecular weight of 329.87 g/mol, XLogP of 3.79, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 4-butoxybenzoate;hydrochloride is sourced from PubChem (CID 16881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).