C26H30ClFN4O3 — CID 168821107
1-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(1-propan-2-ylcyclopropyl)amino]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one (PubChem CID 168821107) has the molecular formula C26H30ClFN4O3 and a molecular weight of 501.00 g/mol. Its IUPAC name is 1-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(1-propan-2-ylcyclopropyl)amino]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one.
| Compound Name | 1-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(1-propan-2-ylcyclopropyl)amino]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 168821107 |
| Molecular Formula | C26H30ClFN4O3 |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-[(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-4-[(1-propan-2-ylcyclopropyl)amino]-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2Cc3c(NC4(C(C)C)CC4)nc(-c4c(O)cccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C26H30ClFN4O3/c1-4-20(34)32-11-10-31-13-17-24(35-14-16(31)12-32)22(27)23(21-18(28)6-5-7-19(21)33)29-25(17)30-26(8-9-26)15(2)3/h4-7,15-16,33H,1,8-14H2,2-3H3,(H,29,30)/t16-/m1/s1 |
| InChIKey | ZQKBYKWELUTJJK-MRXNPFEDSA-N |
| XLogP | 4.44 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|