C26H30ClFN4O3 — CID 168820540
1-[(11R)-7-chloro-2,2-dideuterio-4-(2,2-dimethylpyrrolidin-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one (PubChem CID 168820540) has the molecular formula C26H30ClFN4O3 and a molecular weight of 503.01 g/mol. Its IUPAC name is 1-[(11R)-7-chloro-2,2-dideuterio-4-(2,2-dimethylpyrrolidin-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one.
| Compound Name | 1-[(11R)-7-chloro-2,2-dideuterio-4-(2,2-dimethylpyrrolidin-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 168820540 |
| Molecular Formula | C26H30ClFN4O3 |
| Molecular Weight | 503.01 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 1-[(11R)-7-chloro-2,2-dideuterio-4-(2,2-dimethylpyrrolidin-1-yl)-6-(2-fluoro-6-hydroxyphenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-13-yl]prop-2-en-1-one |
| SMILES | [2H]C1([2H])c2c(N3CCCC3(C)C)nc(-c3c(O)cccc3F)c(Cl)c2OC[C@H]2CN(C(=O)C=C)CCN21 |
| InChI | InChI=1S/C26H30ClFN4O3/c1-4-20(34)31-12-11-30-14-17-24(35-15-16(30)13-31)22(27)23(21-18(28)7-5-8-19(21)33)29-25(17)32-10-6-9-26(32,2)3/h4-5,7-8,16,33H,1,6,9-15H2,2-3H3/t16-/m1/s1/i14D2 |
| InChIKey | DBTFOTDSHUWBDQ-JMRWHTCNSA-N |
| XLogP | 4.22 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.01 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|