C21H22ClFN4O5S — CID 168820374
(11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-N-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-4-sulfonamide (PubChem CID 168820374) has the molecular formula C21H22ClFN4O5S and a molecular weight of 496.95 g/mol. Its IUPAC name is (11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-N-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-4-sulfonamide.
| Compound Name | (11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-N-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-4-sulfonamide |
|---|---|
| PubChem CID | 168820374 |
| Molecular Formula | C21H22ClFN4O5S |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (11R)-7-chloro-6-(2-fluoro-6-hydroxyphenyl)-N-methyl-13-prop-2-enoyl-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-triene-4-sulfonamide |
| SMILES | C=CC(=O)N1CCN2Cc3c(S(=O)(=O)NC)nc(-c4c(O)cccc4F)c(Cl)c3OC[C@H]2C1 |
| InChI | InChI=1S/C21H22ClFN4O5S/c1-3-16(29)27-8-7-26-10-13-20(32-11-12(26)9-27)18(22)19(25-21(13)33(30,31)24-2)17-14(23)5-4-6-15(17)28/h3-6,12,24,28H,1,7-11H2,2H3/t12-/m1/s1 |
| InChIKey | DAAIUBJKUCPSDA-GFCCVEGCSA-N |
| XLogP | 1.75 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|