C23H22ClFN4O3 — CID 155684496
1-[(8R)-12-chloro-13-(2-fluoro-6-hydroxyphenyl)-17-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-6-yl]prop-2-en-1-one (PubChem CID 155684496) has the molecular formula C23H22ClFN4O3 and a molecular weight of 456.91 g/mol. Its IUPAC name is 1-[(8R)-12-chloro-13-(2-fluoro-6-hydroxyphenyl)-17-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(8R)-12-chloro-13-(2-fluoro-6-hydroxyphenyl)-17-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155684496 |
| Molecular Formula | C23H22ClFN4O3 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-[(8R)-12-chloro-13-(2-fluoro-6-hydroxyphenyl)-17-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(18),11,13,15-tetraen-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2Cc3c(c(Cl)c(-c4c(O)cccc4F)c4cnn(C)c34)OC[C@H]2C1 |
| InChI | InChI=1S/C23H22ClFN4O3/c1-3-18(31)29-8-7-28-11-15-22-14(9-26-27(22)2)19(20-16(25)5-4-6-17(20)30)21(24)23(15)32-12-13(28)10-29/h3-6,9,13,30H,1,7-8,10-12H2,2H3/t13-/m1/s1 |
| InChIKey | SQAQLMHSIWCLKG-CYBMUJFWSA-N |
| XLogP | 3.33 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|