C26H27F3N4O3 — CID 155684169
1-[(8R)-12-ethyl-13-[2-hydroxy-6-(trifluoromethyl)phenyl]-16-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),12,14,17-tetraen-6-yl]prop-2-en-1-one (PubChem CID 155684169) has the molecular formula C26H27F3N4O3 and a molecular weight of 500.52 g/mol. Its IUPAC name is 1-[(8R)-12-ethyl-13-[2-hydroxy-6-(trifluoromethyl)phenyl]-16-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),12,14,17-tetraen-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(8R)-12-ethyl-13-[2-hydroxy-6-(trifluoromethyl)phenyl]-16-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),12,14,17-tetraen-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155684169 |
| Molecular Formula | C26H27F3N4O3 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-[(8R)-12-ethyl-13-[2-hydroxy-6-(trifluoromethyl)phenyl]-16-methyl-10-oxa-3,6,16,17-tetrazatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),12,14,17-tetraen-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN2Cc3c(c(CC)c(-c4c(O)cccc4C(F)(F)F)c4cn(C)nc34)OC[C@H]2C1 |
| InChI | InChI=1S/C26H27F3N4O3/c1-4-16-22(23-19(26(27,28)29)7-6-8-20(23)34)17-12-31(3)30-24(17)18-13-32-9-10-33(21(35)5-2)11-15(32)14-36-25(16)18/h5-8,12,15,34H,2,4,9-11,13-14H2,1,3H3/t15-/m1/s1 |
| InChIKey | YXQDBWUZEDBRJG-OAHLLOKOSA-N |
| XLogP | 4.12 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|