About [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate
[1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate (PubChem CID 168822375) has the molecular formula C10H18N4O3
and a molecular weight of 242.28 g/mol. Its IUPAC name is [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate.
Molecular Properties
| Compound Name | [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate |
| PubChem CID | 168822375 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate |
| SMILES | NC(=O)C(=O)OC1CNCCN1[C@@H]1CCNC1 |
| InChI | InChI=1S/C10H18N4O3/c11-9(15)10(16)17-8-6-13-3-4-14(8)7-1-2-12-5-7/h7-8,12-13H,1-6H2,(H2,11,15)/t7-,8?/m1/s1 |
| InChIKey | OJZAYELFOTWKHA-GVHYBUMESA-N |
| XLogP | -2.39 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate?
The IUPAC name of [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate (CID 168822375) is [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate.
What is the SMILES notation for [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate?
The canonical SMILES for [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate is NC(=O)C(=O)OC1CNCCN1[C@@H]1CCNC1.
What is the InChIKey of [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate?
The InChIKey is OJZAYELFOTWKHA-GVHYBUMESA-N. The full InChI is InChI=1S/C10H18N4O3/c11-9(15)10(16)17-8-6-13-3-4-14(8)7-1-2-12-5-7/h7-8,12-13H,1-6H2,(H2,11,15)/t7-,8?/m1/s1.
What are the key properties of [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate?
[1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate has a molecular weight of 242.28 g/mol, XLogP of -2.39, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3R)-pyrrolidin-3-yl]piperazin-2-yl] 2-amino-2-oxoacetate is sourced from PubChem (CID 168822375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).