C17H11F3N4O2 — CID 168825719
5-(azidomethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile (PubChem CID 168825719) has the molecular formula C17H11F3N4O2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 5-(azidomethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile.
| Compound Name | 5-(azidomethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 168825719 |
| Molecular Formula | C17H11F3N4O2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 5-(azidomethyl)-7-[4-(trifluoromethoxy)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile |
| SMILES | N#Cc1c(CN=[N+]=[N-])cc(-c2ccc(OC(F)(F)F)cc2)c2c1CCO2 |
| InChI | InChI=1S/C17H11F3N4O2/c18-17(19,20)26-12-3-1-10(2-4-12)14-7-11(9-23-24-22)15(8-21)13-5-6-25-16(13)14/h1-4,7H,5-6,9H2 |
| InChIKey | ZPDSGKROGLVWBM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 91.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|