C17H13F3N2O — CID 162685701
5-amino-7-[4-(2,2,2-trifluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile (PubChem CID 162685701) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 5-amino-7-[4-(2,2,2-trifluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile.
| Compound Name | 5-amino-7-[4-(2,2,2-trifluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile |
|---|---|
| PubChem CID | 162685701 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-amino-7-[4-(2,2,2-trifluoroethyl)phenyl]-2,3-dihydro-1-benzofuran-4-carbonitrile |
| SMILES | N#Cc1c(N)cc(-c2ccc(CC(F)(F)F)cc2)c2c1CCO2 |
| InChI | InChI=1S/C17H13F3N2O/c18-17(19,20)8-10-1-3-11(4-2-10)13-7-15(22)14(9-21)12-5-6-23-16(12)13/h1-4,7H,5-6,8,22H2 |
| InChIKey | FHJIQYPQGMEOQA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|