C20H27NOS — CID 162685501
ethane;4-methylsulfanyl-7-(4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 162685501) has the molecular formula C20H27NOS and a molecular weight of 329.51 g/mol. Its IUPAC name is ethane;4-methylsulfanyl-7-(4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | ethane;4-methylsulfanyl-7-(4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 162685501 |
| Molecular Formula | C20H27NOS |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | ethane;4-methylsulfanyl-7-(4-propan-2-ylphenyl)-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | CC.CSc1c(N)cc(-c2ccc(C(C)C)cc2)c2c1CCO2 |
| InChI | InChI=1S/C18H21NOS.C2H6/c1-11(2)12-4-6-13(7-5-12)15-10-16(19)18(21-3)14-8-9-20-17(14)15;1-2/h4-7,10-11H,8-9,19H2,1-3H3;1-2H3 |
| InChIKey | GMTIISUJDVTKJU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|