C22H27FN2O — CID 162685619
5-amino-7-(2-fluoro-4-prop-1-en-2-ylphenyl)-2,3-dihydro-1-benzofuran-4-carbonitrile;ethane (PubChem CID 162685619) has the molecular formula C22H27FN2O and a molecular weight of 354.47 g/mol. Its IUPAC name is 5-amino-7-(2-fluoro-4-prop-1-en-2-ylphenyl)-2,3-dihydro-1-benzofuran-4-carbonitrile;ethane.
| Compound Name | 5-amino-7-(2-fluoro-4-prop-1-en-2-ylphenyl)-2,3-dihydro-1-benzofuran-4-carbonitrile;ethane |
|---|---|
| PubChem CID | 162685619 |
| Molecular Formula | C22H27FN2O |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 5-amino-7-(2-fluoro-4-prop-1-en-2-ylphenyl)-2,3-dihydro-1-benzofuran-4-carbonitrile;ethane |
| SMILES | C=C(C)c1ccc(-c2cc(N)c(C#N)c3c2OCC3)c(F)c1.CC.CC |
| InChI | InChI=1S/C18H15FN2O.2C2H6/c1-10(2)11-3-4-12(16(19)7-11)14-8-17(21)15(9-20)13-5-6-22-18(13)14;2*1-2/h3-4,7-8H,1,5-6,21H2,2H3;2*1-2H3 |
| InChIKey | AEFMECCZDWRKIF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|