C37H72N4O7+2 — CID 168834926
N,N'-bis[1-[3-(2-ethylhexoxy)-2-hydroxypropyl]piperidin-1-ium-1-yl]-3-oxopentanediamide (PubChem CID 168834926) has the molecular formula C37H72N4O7+2 and a molecular weight of 685.00 g/mol. Its IUPAC name is N,N'-bis[1-[3-(2-ethylhexoxy)-2-hydroxypropyl]piperidin-1-ium-1-yl]-3-oxopentanediamide.
| Compound Name | N,N'-bis[1-[3-(2-ethylhexoxy)-2-hydroxypropyl]piperidin-1-ium-1-yl]-3-oxopentanediamide |
|---|---|
| PubChem CID | 168834926 |
| Molecular Formula | C37H72N4O7+2 |
| Molecular Weight | 685.00 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | N,N'-bis[1-[3-(2-ethylhexoxy)-2-hydroxypropyl]piperidin-1-ium-1-yl]-3-oxopentanediamide |
| SMILES | CCCCC(CC)COCC(O)C[N+]1(NC(=O)CC(=O)CC(=O)N[N+]2(CC(O)COCC(CC)CCCC)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C37H70N4O7/c1-5-9-17-31(7-3)27-47-29-34(43)25-40(19-13-11-14-20-40)38-36(45)23-33(42)24-37(46)39-41(21-15-12-16-22-41)26-35(44)30-48-28-32(8-4)18-10-6-2/h31-32,34-35,43-44H,5-30H2,1-4H3/p+2 |
| InChIKey | WTYZBGIWNGDDCF-UHFFFAOYSA-P |
| XLogP | 4.59 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|