C15H32N2O3 — CID 61464333
2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-N-methylpropanamide (PubChem CID 61464333) has the molecular formula C15H32N2O3 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-N-methylpropanamide.
| Compound Name | 2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 61464333 |
| Molecular Formula | C15H32N2O3 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.24 |
| IUPAC Name | 2-[[3-(2-ethylhexoxy)-2-hydroxypropyl]amino]-N-methylpropanamide |
| SMILES | CCCCC(CC)COCC(O)CNC(C)C(=O)NC |
| InChI | InChI=1S/C15H32N2O3/c1-5-7-8-13(6-2)10-20-11-14(18)9-17-12(3)15(19)16-4/h12-14,17-18H,5-11H2,1-4H3,(H,16,19) |
| InChIKey | MPKLGRHMNYJWPW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |