C19H20N2O3S — CID 168838042
(5R)-5-deuterio-5-[[4-[2-[5-(1,1,2,2,2-pentadeuterioethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 168838042) has the molecular formula C19H20N2O3S and a molecular weight of 362.48 g/mol. Its IUPAC name is (5R)-5-deuterio-5-[[4-[2-[5-(1,1,2,2,2-pentadeuterioethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5R)-5-deuterio-5-[[4-[2-[5-(1,1,2,2,2-pentadeuterioethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 168838042 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (5R)-5-deuterio-5-[[4-[2-[5-(1,1,2,2,2-pentadeuterioethyl)-2-pyridinyl]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1ccc(CCOc2ccc(C[C@@]3([2H])SC(=O)NC3=O)cc2)nc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23)/t17-/m1/s1/i1D3,2D2,17D |
| InChIKey | HYAFETHFCAUJAY-CPOJVRQXSA-N |
| XLogP | 3.16 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|