C18H29BrN2O2 — CID 168838111
1-(3-bromocyclohexyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 168838111) has the molecular formula C18H29BrN2O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 1-(3-bromocyclohexyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-(3-bromocyclohexyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 168838111 |
| Molecular Formula | C18H29BrN2O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-(3-bromocyclohexyl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | O=C(O)C1CC2C3CCCCC3NC2C(C2CCCC(Br)C2)N1 |
| InChI | InChI=1S/C18H29BrN2O2/c19-11-5-3-4-10(8-11)16-17-13(9-15(21-16)18(22)23)12-6-1-2-7-14(12)20-17/h10-17,20-21H,1-9H2,(H,22,23) |
| InChIKey | XGUOKDYKSDINJQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|