C29H42ClN5O6 — CID 168850503
tert-butyl (3S)-4-[6-chloro-2-[(6S,7E)-7-hydroxyimino-1,4-dioxadispiro[4.0.56.45]pentadecane-8-carbonyl]pyrimidin-4-yl]-3-methyl-1,4-diazepane-1-carboxylate (PubChem CID 168850503) has the molecular formula C29H42ClN5O6 and a molecular weight of 592.14 g/mol. Its IUPAC name is tert-butyl (3S)-4-[6-chloro-2-[(6S,7E)-7-hydroxyimino-1,4-dioxadispiro[4.0.56.45]pentadecane-8-carbonyl]pyrimidin-4-yl]-3-methyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[6-chloro-2-[(6S,7E)-7-hydroxyimino-1,4-dioxadispiro[4.0.56.45]pentadecane-8-carbonyl]pyrimidin-4-yl]-3-methyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 168850503 |
| Molecular Formula | C29H42ClN5O6 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | tert-butyl (3S)-4-[6-chloro-2-[(6S,7E)-7-hydroxyimino-1,4-dioxadispiro[4.0.56.45]pentadecane-8-carbonyl]pyrimidin-4-yl]-3-methyl-1,4-diazepane-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCCN1c1cc(Cl)nc(C(=O)C2CCC[C@@]3(CCCCC34OCCO4)/C2=N/O)n1 |
| InChI | InChI=1S/C29H42ClN5O6/c1-19-18-34(26(37)41-27(2,3)4)13-8-14-35(19)22-17-21(30)31-25(32-22)23(36)20-9-7-11-28(24(20)33-38)10-5-6-12-29(28)39-15-16-40-29/h17,19-20,38H,5-16,18H2,1-4H3/b33-24+/t19-,20?,28-/m0/s1 |
| InChIKey | ZNEYFJPKGFRUAA-XQLFFNMBSA-N |
| XLogP | 5.08 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|