C37H32O5 — CID 168851540
10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene (PubChem CID 168851540) has the molecular formula C37H32O5 and a molecular weight of 556.66 g/mol. Its IUPAC name is 10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene.
| Compound Name | 10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 168851540 |
| Molecular Formula | C37H32O5 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-21-methyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c4c(c5cc(OC)c(OC)cc5c3O2)-c2ccccc2C4C)cc1 |
| InChI | InChI=1S/C37H32O5/c1-22-27-8-6-7-9-28(27)35-30-20-32(40-4)33(41-5)21-31(30)36-29(34(22)35)18-19-37(42-36,23-10-14-25(38-2)15-11-23)24-12-16-26(39-3)17-13-24/h6-22H,1-5H3 |
| InChIKey | GTEJVCKPQIZHTG-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |