C42H41NO2 — CID 23573971
4-(10-methoxy-25,25-dimethyl-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline (PubChem CID 23573971) has the molecular formula C42H41NO2 and a molecular weight of 591.80 g/mol. Its IUPAC name is 4-(10-methoxy-25,25-dimethyl-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline.
| Compound Name | 4-(10-methoxy-25,25-dimethyl-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23573971 |
| Molecular Formula | C42H41NO2 |
| Molecular Weight | 591.80 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | 4-(10-methoxy-25,25-dimethyl-5-phenyl-6-oxahexacyclo[12.12.0.02,7.08,13.015,20.021,26]hexacosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)-N,N-dimethylaniline |
| SMILES | COc1ccc2c3c(c4c(c2c1)OC(c1ccccc1)(c1ccc(N(C)C)cc1)C=C4)C1C(CCCC1(C)C)c1ccccc1-3 |
| InChI | InChI=1S/C42H41NO2/c1-41(2)24-11-16-34-31-14-9-10-15-32(31)37-33-22-21-30(44-5)26-36(33)40-35(38(37)39(34)41)23-25-42(45-40,27-12-7-6-8-13-27)28-17-19-29(20-18-28)43(3)4/h6-10,12-15,17-23,25-26,34,39H,11,16,24H2,1-5H3 |
| InChIKey | TVWPWIIRHSNLNG-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.80 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|