C13H21N — CID 168854266
2-propan-2-yltetracyclo[3.3.1.11,3.02,7]decan-3-amine (PubChem CID 168854266) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-propan-2-yltetracyclo[3.3.1.11,3.02,7]decan-3-amine.
| Compound Name | 2-propan-2-yltetracyclo[3.3.1.11,3.02,7]decan-3-amine |
|---|---|
| PubChem CID | 168854266 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-propan-2-yltetracyclo[3.3.1.11,3.02,7]decan-3-amine |
| SMILES | CC(C)C12C3CC4CC1(N)CC2(C4)C3 |
| InChI | InChI=1S/C13H21N/c1-8(2)13-10-3-9-4-11(13,6-10)7-12(13,14)5-9/h8-10H,3-7,14H2,1-2H3 |
| InChIKey | QCTIIQUIRFKLDO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |