C12H21N3 — CID 91498453
spiro[adamantane-2,2'-imidazolidine]-1-amine (PubChem CID 91498453) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is spiro[adamantane-2,2'-imidazolidine]-1-amine.
| Compound Name | spiro[adamantane-2,2'-imidazolidine]-1-amine |
|---|---|
| PubChem CID | 91498453 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | spiro[adamantane-2,2'-imidazolidine]-1-amine |
| SMILES | NC12CC3CC(CC(C3)C13NCCN3)C2 |
| InChI | InChI=1S/C12H21N3/c13-11-6-8-3-9(7-11)5-10(4-8)12(11)14-1-2-15-12/h8-10,14-15H,1-7,13H2 |
| InChIKey | UDJTURBORRVVDB-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |