C57H104N2O7 — CID 168858023
[(9Z,12Z)-octadeca-9,12-dienyl] 3-[3-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]propoxy]propanoate (PubChem CID 168858023) has the molecular formula C57H104N2O7 and a molecular weight of 929.47 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 3-[3-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]propoxy]propanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[3-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]propoxy]propanoate |
|---|---|
| PubChem CID | 168858023 |
| Molecular Formula | C57H104N2O7 |
| Molecular Weight | 929.47 g/mol |
| Exact Mass | 928.78 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[3-[2-[cycloheptyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-[(9Z,12Z)-octadeca-9,12-dienoxy]-3-oxopropoxy]propoxy]propanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CCOCC(CN(C)CCN(CCO)C1CCCCCC1)OCCC(=O)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C57H104N2O7/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-34-38-48-65-56(61)42-50-63-53-55(52-58(3)44-45-59(46-47-60)54-40-36-32-33-37-41-54)64-51-43-57(62)66-49-39-35-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,54-55,60H,4-11,16-17,22-53H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | VDXFTGHVLHSUAO-QYCRHRGJSA-N |
| XLogP | 13.83 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.47 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|