C54H107N3O6 — CID 168858029
2-octyldecyl 3-[3-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-(2-octyldecylamino)-3-oxopropoxy]propoxy]propanoate (PubChem CID 168858029) has the molecular formula C54H107N3O6 and a molecular weight of 894.46 g/mol. Its IUPAC name is 2-octyldecyl 3-[3-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-(2-octyldecylamino)-3-oxopropoxy]propoxy]propanoate.
| Compound Name | 2-octyldecyl 3-[3-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-(2-octyldecylamino)-3-oxopropoxy]propoxy]propanoate |
|---|---|
| PubChem CID | 168858029 |
| Molecular Formula | C54H107N3O6 |
| Molecular Weight | 894.46 g/mol |
| Exact Mass | 893.82 |
| IUPAC Name | 2-octyldecyl 3-[3-[2-[cyclobutyl(2-hydroxyethyl)amino]ethyl-methylamino]-2-[3-(2-octyldecylamino)-3-oxopropoxy]propoxy]propanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CNC(=O)CCOC(COCCC(=O)OCC(CCCCCCCC)CCCCCCCC)CN(C)CCN(CCO)C1CCC1 |
| InChI | InChI=1S/C54H107N3O6/c1-6-10-14-18-22-26-31-49(32-27-23-19-15-11-7-2)45-55-53(59)37-44-62-52(46-56(5)39-40-57(41-42-58)51-35-30-36-51)48-61-43-38-54(60)63-47-50(33-28-24-20-16-12-8-3)34-29-25-21-17-13-9-4/h49-52,58H,6-48H2,1-5H3,(H,55,59) |
| InChIKey | JHTUHHYLLHKZIX-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.46 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|